C22H20ClF3N2O — CID 169233958
2-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 169233958) has the molecular formula C22H20ClF3N2O and a molecular weight of 420.86 g/mol. Its IUPAC name is 2-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | 2-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 169233958 |
| Molecular Formula | C22H20ClF3N2O |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | CCOc1c(C)cc(C(CN)c2ccc(F)cc2)nc1-c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C22H20ClF3N2O/c1-3-29-22-12(2)8-20(16(11-27)13-4-6-14(24)7-5-13)28-21(22)15-9-17(23)19(26)10-18(15)25/h4-10,16H,3,11,27H2,1-2H3 |
| InChIKey | NNZLMAXAQSVKLT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|