C20H23ClF2N4O — CID 169234094
(Z)-4-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-3-methyliminopent-1-ene-1,5-diamine (PubChem CID 169234094) has the molecular formula C20H23ClF2N4O and a molecular weight of 408.88 g/mol. Its IUPAC name is (Z)-4-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-3-methyliminopent-1-ene-1,5-diamine.
| Compound Name | (Z)-4-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-3-methyliminopent-1-ene-1,5-diamine |
|---|---|
| PubChem CID | 169234094 |
| Molecular Formula | C20H23ClF2N4O |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (Z)-4-[6-(5-chloro-2,4-difluorophenyl)-5-ethoxy-4-methyl-2-pyridinyl]-3-methyliminopent-1-ene-1,5-diamine |
| SMILES | CCOc1c(C)cc(C(CN)C(/C=C\N)=N\C)nc1-c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C20H23ClF2N4O/c1-4-28-20-11(2)7-18(13(10-25)17(26-3)5-6-24)27-19(20)12-8-14(21)16(23)9-15(12)22/h5-9,13H,4,10,24-25H2,1-3H3/b6-5-,26-17- |
| InChIKey | RHBFUFCUGFWLFQ-YQZJSGAYSA-N |
| XLogP | 3.97 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|