C23H21F3N2O — CID 169234153
2-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-2-phenylethanamine (PubChem CID 169234153) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-2-phenylethanamine.
| Compound Name | 2-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-2-phenylethanamine |
|---|---|
| PubChem CID | 169234153 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[3,3-dimethyl-7-(2,4,5-trifluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-2-phenylethanamine |
| SMILES | CC1(C)COc2c1cc(C(CN)c1ccccc1)nc2-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H21F3N2O/c1-23(2)12-29-22-16(23)9-20(15(11-27)13-6-4-3-5-7-13)28-21(22)14-8-18(25)19(26)10-17(14)24/h3-10,15H,11-12,27H2,1-2H3 |
| InChIKey | UYIMBTKSLPIFCX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|