About (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole
(4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole (PubChem CID 169235470) has the molecular formula C16H17FN2
and a molecular weight of 256.32 g/mol. Its IUPAC name is (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 169235470 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole |
| SMILES | CC1CC(F)=CC=C1C1=NNC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17FN2/c1-11-9-13(17)7-8-14(11)16-15(10-18-19-16)12-5-3-2-4-6-12/h2-8,11,15,18H,9-10H2,1H3/t11?,15-/m1/s1 |
| InChIKey | QFGIBVLETJMWLM-JOPIAHFSSA-N |
| XLogP | 3.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole?
The IUPAC name of (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole (CID 169235470) is (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole is CC1CC(F)=CC=C1C1=NNC[C@@H]1c1ccccc1.
What is the InChIKey of (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole?
The InChIKey is QFGIBVLETJMWLM-JOPIAHFSSA-N. The full InChI is InChI=1S/C16H17FN2/c1-11-9-13(17)7-8-14(11)16-15(10-18-19-16)12-5-3-2-4-6-12/h2-8,11,15,18H,9-10H2,1H3/t11?,15-/m1/s1.
What are the key properties of (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole?
(4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole has a molecular weight of 256.32 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-4-phenyl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 169235470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).