C24H29N3 — CID 169235816
4,8-dimethylquinazoline;ethane;4-propan-2-ylisoquinoline (PubChem CID 169235816) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is 4,8-dimethylquinazoline;ethane;4-propan-2-ylisoquinoline.
| Compound Name | 4,8-dimethylquinazoline;ethane;4-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 169235816 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 4,8-dimethylquinazoline;ethane;4-propan-2-ylisoquinoline |
| SMILES | CC.CC(C)c1cncc2ccccc12.Cc1ncnc2c(C)cccc12 |
| InChI | InChI=1S/C12H13N.C10H10N2.C2H6/c1-9(2)12-8-13-7-10-5-3-4-6-11(10)12;1-7-4-3-5-9-8(2)11-6-12-10(7)9;1-2/h3-9H,1-2H3;3-6H,1-2H3;1-2H3 |
| InChIKey | LPMOBRLRUKJYNZ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |