C25H26F2N2O2 — CID 169235840
2-[5-[[(3E)-2-cyclohexa-1,3-dien-1-ylhexa-1,3,5-trien-3-yl]oxymethyl]-4-ethylcyclohepta-1,4,6-trien-1-yl]-5-(difluoromethyl)-1,3,4-oxadiazole (PubChem CID 169235840) has the molecular formula C25H26F2N2O2 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[5-[[(3E)-2-cyclohexa-1,3-dien-1-ylhexa-1,3,5-trien-3-yl]oxymethyl]-4-ethylcyclohepta-1,4,6-trien-1-yl]-5-(difluoromethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[5-[[(3E)-2-cyclohexa-1,3-dien-1-ylhexa-1,3,5-trien-3-yl]oxymethyl]-4-ethylcyclohepta-1,4,6-trien-1-yl]-5-(difluoromethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 169235840 |
| Molecular Formula | C25H26F2N2O2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-[5-[[(3E)-2-cyclohexa-1,3-dien-1-ylhexa-1,3,5-trien-3-yl]oxymethyl]-4-ethylcyclohepta-1,4,6-trien-1-yl]-5-(difluoromethyl)-1,3,4-oxadiazole |
| SMILES | C=C/C=C(/OCC1=C(CC)CC=C(c2nnc(C(F)F)o2)C=C1)C(=C)C1=CC=CCC1 |
| InChI | InChI=1S/C25H26F2N2O2/c1-4-9-22(17(3)19-10-7-6-8-11-19)30-16-21-15-14-20(13-12-18(21)5-2)24-28-29-25(31-24)23(26)27/h4,6-7,9-10,13-15,23H,1,3,5,8,11-12,16H2,2H3/b22-9+ |
| InChIKey | PHEIWRFNCWQJFT-LSFURLLWSA-N |
| XLogP | 6.98 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|