C19H22F3IN5O3P — CID 169236469
ethane;6-[1-iodophosphanyl-5-(trifluoromethoxy)indazol-3-yl]-2-methyl-4-morpholin-4-ylpyridazin-3-one (PubChem CID 169236469) has the molecular formula C19H22F3IN5O3P and a molecular weight of 583.29 g/mol. Its IUPAC name is ethane;6-[1-iodophosphanyl-5-(trifluoromethoxy)indazol-3-yl]-2-methyl-4-morpholin-4-ylpyridazin-3-one.
| Compound Name | ethane;6-[1-iodophosphanyl-5-(trifluoromethoxy)indazol-3-yl]-2-methyl-4-morpholin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 169236469 |
| Molecular Formula | C19H22F3IN5O3P |
| Molecular Weight | 583.29 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | ethane;6-[1-iodophosphanyl-5-(trifluoromethoxy)indazol-3-yl]-2-methyl-4-morpholin-4-ylpyridazin-3-one |
| SMILES | CC.Cn1nc(-c2nn(PI)c3ccc(OC(F)(F)F)cc23)cc(N2CCOCC2)c1=O |
| InChI | InChI=1S/C17H16F3IN5O3P.C2H6/c1-24-16(27)14(25-4-6-28-7-5-25)9-12(22-24)15-11-8-10(29-17(18,19)20)2-3-13(11)26(23-15)30-21;1-2/h2-3,8-9,30H,4-7H2,1H3;1-2H3 |
| InChIKey | OGQRYFAISOYMEW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|