About ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine
ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine (PubChem CID 169237343) has the molecular formula C7H15N3O2
and a molecular weight of 173.22 g/mol. Its IUPAC name is ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 169237343 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine |
| SMILES | CC.CNc1nc(COC)no1 |
| InChI | InChI=1S/C5H9N3O2.C2H6/c1-6-5-7-4(3-9-2)8-10-5;1-2/h3H2,1-2H3,(H,6,7,8);1-2H3 |
| InChIKey | WAYRUSJPXCHORJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine (CID 169237343) is ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine is CC.CNc1nc(COC)no1.
What is the InChIKey of ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine?
The InChIKey is WAYRUSJPXCHORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2.C2H6/c1-6-5-7-4(3-9-2)8-10-5;1-2/h3H2,1-2H3,(H,6,7,8);1-2H3.
What are the key properties of ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine?
ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine has a molecular weight of 173.22 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(methoxymethyl)-N-methyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 169237343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).