About ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine
ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine (PubChem CID 169237602) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine |
| PubChem CID | 169237602 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine |
| SMILES | CC.CNc1nccc2c1CCO2 |
| InChI | InChI=1S/C8H10N2O.C2H6/c1-9-8-6-3-5-11-7(6)2-4-10-8;1-2/h2,4H,3,5H2,1H3,(H,9,10);1-2H3 |
| InChIKey | SHJQPEIDNUMDEP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine?
The IUPAC name of ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine (CID 169237602) is ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine.
What is the SMILES notation for ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine?
The canonical SMILES for ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine is CC.CNc1nccc2c1CCO2.
What is the InChIKey of ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine?
The InChIKey is SHJQPEIDNUMDEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C2H6/c1-9-8-6-3-5-11-7(6)2-4-10-8;1-2/h2,4H,3,5H2,1H3,(H,9,10);1-2H3.
What are the key properties of ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine?
ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine has a molecular weight of 180.25 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2,3-dihydrofuro[3,2-c]pyridin-4-amine is sourced from PubChem (CID 169237602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).