C24H23N7O — CID 169237778
N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenyl-6-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 169237778) has the molecular formula C24H23N7O and a molecular weight of 425.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenyl-6-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenyl-6-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 169237778 |
| Molecular Formula | C24H23N7O |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenyl-6-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | COCCNc1nc(-c2nccn2C)nn2cc(-c3ccncc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C24H23N7O/c1-30-14-12-27-24(30)23-28-22(26-13-15-32-2)21-20(18-6-4-3-5-7-18)19(16-31(21)29-23)17-8-10-25-11-9-17/h3-12,14,16H,13,15H2,1-2H3,(H,26,28,29) |
| InChIKey | ZKKNJNWKNUNZFC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|