C30H28Cl2FNO2S — CID 169239176
3-(2,4-dichlorophenyl)-4-[4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-2H-thiochromene-7-carboxylic acid (PubChem CID 169239176) has the molecular formula C30H28Cl2FNO2S and a molecular weight of 556.53 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-[4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-2H-thiochromene-7-carboxylic acid.
| Compound Name | 3-(2,4-dichlorophenyl)-4-[4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-2H-thiochromene-7-carboxylic acid |
|---|---|
| PubChem CID | 169239176 |
| Molecular Formula | C30H28Cl2FNO2S |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-[4-[[1-(3-fluoropropyl)pyrrolidin-3-yl]methyl]phenyl]-2H-thiochromene-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)SCC(c1ccc(Cl)cc1Cl)=C2c1ccc(CC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C30H28Cl2FNO2S/c31-23-7-9-24(27(32)16-23)26-18-37-28-15-22(30(35)36)6-8-25(28)29(26)21-4-2-19(3-5-21)14-20-10-13-34(17-20)12-1-11-33/h2-9,15-16,20H,1,10-14,17-18H2,(H,35,36) |
| InChIKey | HUVXWQMUXZYCGL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|