About N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride
N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride (PubChem CID 169240282) has the molecular formula C5H11ClF2N2O2S
and a molecular weight of 236.67 g/mol. Its IUPAC name is N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride |
| PubChem CID | 169240282 |
| Molecular Formula | C5H11ClF2N2O2S |
| Molecular Weight | 236.67 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)N[C@@H]1CNCC1(F)F.Cl |
| InChI | InChI=1S/C5H10F2N2O2S.ClH/c1-12(10,11)9-4-2-8-3-5(4,6)7;/h4,8-9H,2-3H2,1H3;1H/t4-;/m1./s1 |
| InChIKey | CRNDAGRFWBXILE-PGMHMLKASA-N |
| XLogP | -0.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.67 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride?
The IUPAC name of N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride (CID 169240282) is N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride.
What is the SMILES notation for N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride?
The canonical SMILES for N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride is CS(=O)(=O)N[C@@H]1CNCC1(F)F.Cl.
What is the InChIKey of N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride?
The InChIKey is CRNDAGRFWBXILE-PGMHMLKASA-N. The full InChI is InChI=1S/C5H10F2N2O2S.ClH/c1-12(10,11)9-4-2-8-3-5(4,6)7;/h4,8-9H,2-3H2,1H3;1H/t4-;/m1./s1.
What are the key properties of N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride?
N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride has a molecular weight of 236.67 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-4,4-difluoropyrrolidin-3-yl]methanesulfonamide;hydrochloride is sourced from PubChem (CID 169240282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).