C35H42N4O3 — CID 169240670
(7R)-7-benzyl-9-butyl-N-(3,3-diphenylpropyl)-4,8-dioxo-2,3,6,7,10,10a-hexahydropyrimido[1,2-a][1,4]diazepine-1-carboxamide (PubChem CID 169240670) has the molecular formula C35H42N4O3 and a molecular weight of 566.75 g/mol. Its IUPAC name is (7R)-7-benzyl-9-butyl-N-(3,3-diphenylpropyl)-4,8-dioxo-2,3,6,7,10,10a-hexahydropyrimido[1,2-a][1,4]diazepine-1-carboxamide.
| Compound Name | (7R)-7-benzyl-9-butyl-N-(3,3-diphenylpropyl)-4,8-dioxo-2,3,6,7,10,10a-hexahydropyrimido[1,2-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 169240670 |
| Molecular Formula | C35H42N4O3 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | (7R)-7-benzyl-9-butyl-N-(3,3-diphenylpropyl)-4,8-dioxo-2,3,6,7,10,10a-hexahydropyrimido[1,2-a][1,4]diazepine-1-carboxamide |
| SMILES | CCCCN1CC2N(C[C@@H](Cc3ccccc3)C1=O)C(=O)CCN2C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H42N4O3/c1-2-3-22-37-26-32-38(23-20-33(40)39(32)25-30(34(37)41)24-27-13-7-4-8-14-27)35(42)36-21-19-31(28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-18,30-32H,2-3,19-26H2,1H3,(H,36,42)/t30-,32?/m1/s1 |
| InChIKey | KARDVHBMRKKYPT-VETVTEPKSA-N |
| XLogP | 5.28 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |