About 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium
2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium (PubChem CID 169241255) has the molecular formula C8H3F3NSY-
and a molecular weight of 291.09 g/mol. Its IUPAC name is 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium |
| PubChem CID | 169241255 |
| Molecular Formula | C8H3F3NSY- |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.90 |
| IUPAC Name | 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium |
| SMILES | FC(F)(F)c1nc2cc[c-]cc2s1.[Y] |
| InChI | InChI=1S/C8H3F3NS.Y/c9-8(10,11)7-12-5-3-1-2-4-6(5)13-7;/h1,3-4H;/q-1; |
| InChIKey | FLCXJPVRDQGASJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium?
The IUPAC name of 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium (CID 169241255) is 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium.
What is the SMILES notation for 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium?
The canonical SMILES for 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium is FC(F)(F)c1nc2cc[c-]cc2s1.[Y].
What is the InChIKey of 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium?
The InChIKey is FLCXJPVRDQGASJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F3NS.Y/c9-8(10,11)7-12-5-3-1-2-4-6(5)13-7;/h1,3-4H;/q-1;.
What are the key properties of 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium?
2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium has a molecular weight of 291.09 g/mol, XLogP of 3.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-6H-1,3-benzothiazol-6-ide;yttrium is sourced from PubChem (CID 169241255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).