C26H25ClF5N5O3S — CID 169241279
4-chloro-6-[3,3,3-trifluoro-2-[3-(fluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-2,3-dihydro-1,3-benzothiazol-2-amine;formamide (PubChem CID 169241279) has the molecular formula C26H25ClF5N5O3S and a molecular weight of 618.03 g/mol. Its IUPAC name is 4-chloro-6-[3,3,3-trifluoro-2-[3-(fluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-2,3-dihydro-1,3-benzothiazol-2-amine;formamide.
| Compound Name | 4-chloro-6-[3,3,3-trifluoro-2-[3-(fluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-2,3-dihydro-1,3-benzothiazol-2-amine;formamide |
|---|---|
| PubChem CID | 169241279 |
| Molecular Formula | C26H25ClF5N5O3S |
| Molecular Weight | 618.03 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | 4-chloro-6-[3,3,3-trifluoro-2-[3-(fluoromethyl)-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]-2,3-dihydro-1,3-benzothiazol-2-amine;formamide |
| SMILES | NC1Nc2c(Cl)cc(CC(c3cc4c(c(-c5ccc(F)cc5)n3)OCC4CF)C(F)(F)F)cc2S1.NC=O.NC=O |
| InChI | InChI=1S/C24H19ClF5N3OS.2CH3NO/c25-17-6-11(7-19-21(17)33-23(31)35-19)5-16(24(28,29)30)18-8-15-13(9-26)10-34-22(15)20(32-18)12-1-3-14(27)4-2-12;2*2-1-3/h1-4,6-8,13,16,23,33H,5,9-10,31H2;2*1H,(H2,2,3) |
| InChIKey | WWUASYGOPXOUGC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.03 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|