C19H28FN3O4S — CID 169241965
5-[2-fluoro-4-[(1-hexylpyrrolidin-3-yl)methyl]-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 169241965) has the molecular formula C19H28FN3O4S and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-[2-fluoro-4-[(1-hexylpyrrolidin-3-yl)methyl]-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-4-[(1-hexylpyrrolidin-3-yl)methyl]-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 169241965 |
| Molecular Formula | C19H28FN3O4S |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-[2-fluoro-4-[(1-hexylpyrrolidin-3-yl)methyl]-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CCCCCCN1CCC(Cc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2)C1 |
| InChI | InChI=1S/C19H28FN3O4S/c1-2-3-4-5-7-22-8-6-14(12-22)9-15-10-16(20)19(17(24)11-15)23-13-18(25)21-28(23,26)27/h10-11,14,24H,2-9,12-13H2,1H3,(H,21,25) |
| InChIKey | JIRPHRQMGVQNQZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|