C18H26FN3O4S — CID 169242000
5-[2-fluoro-6-hydroxy-4-[(1-pentylpyrrolidin-3-yl)methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 169242000) has the molecular formula C18H26FN3O4S and a molecular weight of 399.49 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-4-[(1-pentylpyrrolidin-3-yl)methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-4-[(1-pentylpyrrolidin-3-yl)methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 169242000 |
| Molecular Formula | C18H26FN3O4S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-4-[(1-pentylpyrrolidin-3-yl)methyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CCCCCN1CCC(Cc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2)C1 |
| InChI | InChI=1S/C18H26FN3O4S/c1-2-3-4-6-21-7-5-13(11-21)8-14-9-15(19)18(16(23)10-14)22-12-17(24)20-27(22,25)26/h9-10,13,23H,2-8,11-12H2,1H3,(H,20,24) |
| InChIKey | FIONJSRIEWWQRM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|