C15H17F4N3O4S — CID 169242045
5-[2-fluoro-6-hydroxy-4-[2-[3-(2,2,2-trifluoroethyl)azetidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 169242045) has the molecular formula C15H17F4N3O4S and a molecular weight of 411.38 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-4-[2-[3-(2,2,2-trifluoroethyl)azetidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-4-[2-[3-(2,2,2-trifluoroethyl)azetidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 169242045 |
| Molecular Formula | C15H17F4N3O4S |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-4-[2-[3-(2,2,2-trifluoroethyl)azetidin-1-yl]ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc(CCN3CC(CC(F)(F)F)C3)cc2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H17F4N3O4S/c16-11-3-9(1-2-21-6-10(7-21)5-15(17,18)19)4-12(23)14(11)22-8-13(24)20-27(22,25)26/h3-4,10,23H,1-2,5-8H2,(H,20,24) |
| InChIKey | LWBOATFZTRSLJY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |