About 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine
3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine (PubChem CID 169242290) has the molecular formula C18H38F2N2
and a molecular weight of 320.51 g/mol. Its IUPAC name is 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine.
Molecular Properties
| Compound Name | 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine |
| PubChem CID | 169242290 |
| Molecular Formula | C18H38F2N2 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.30 |
| IUPAC Name | 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine |
| SMILES | CC.CC(C)CCN1CCCC1.CCCN1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H19N.C7H13F2N.C2H6/c1-9(2)5-8-10-6-3-4-7-10;1-2-4-10-5-3-7(8,9)6-10;1-2/h9H,3-8H2,1-2H3;2-6H2,1H3;1-2H3 |
| InChIKey | FVPLCZWMFBEBKN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine?
The IUPAC name of 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine (CID 169242290) is 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine.
What is the SMILES notation for 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine?
The canonical SMILES for 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine is CC.CC(C)CCN1CCCC1.CCCN1CCC(F)(F)C1.
What is the InChIKey of 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine?
The InChIKey is FVPLCZWMFBEBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C7H13F2N.C2H6/c1-9(2)5-8-10-6-3-4-7-10;1-2-4-10-5-3-7(8,9)6-10;1-2/h9H,3-8H2,1-2H3;2-6H2,1H3;1-2H3.
What are the key properties of 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine?
3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine has a molecular weight of 320.51 g/mol, XLogP of 4.89, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-propylpyrrolidine;ethane;1-(3-methylbutyl)pyrrolidine is sourced from PubChem (CID 169242290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).