About 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide
3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide (PubChem CID 169243830) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide |
| PubChem CID | 169243830 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide |
| SMILES | CNNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H11N3O3/c1-9-10-6(12)4-5-11-7(13)2-3-8(11)14/h2-3,9H,4-5H2,1H3,(H,10,12) |
| InChIKey | GMYFUNBQTXFJPQ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
The IUPAC name of 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide (CID 169243830) is 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide.
What is the SMILES notation for 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
The canonical SMILES for 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide is CNNC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
The InChIKey is GMYFUNBQTXFJPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-9-10-6(12)4-5-11-7(13)2-3-8(11)14/h2-3,9H,4-5H2,1H3,(H,10,12).
What are the key properties of 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide?
3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide has a molecular weight of 197.19 g/mol, XLogP of -1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrol-1-yl)-N'-methylpropanehydrazide is sourced from PubChem (CID 169243830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).