C23H22FN3O3S2 — CID 16924401
N-(5,7-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 16924401) has the molecular formula C23H22FN3O3S2 and a molecular weight of 471.58 g/mol. Its IUPAC name is N-(5,7-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(5,7-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16924401 |
| Molecular Formula | C23H22FN3O3S2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-(5,7-dimethyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2ccc(F)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C23H22FN3O3S2/c1-4-11-26-20-14-15(2)13-16(3)21(20)31-23(26)25-22(28)19-6-5-12-27(19)32(29,30)18-9-7-17(24)8-10-18/h1,7-10,13-14,19H,5-6,11-12H2,2-3H3/b25-23- |
| InChIKey | HWIKHGHIRRJDIQ-BZZOAKBMSA-N |
| XLogP | 3.37 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|