C15H13Cl2N4O3S+ — CID 169244116
2-[[1-(2,4-dichlorophenyl)-2,3-dihydrotetrazol-2-ium-5-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 169244116) has the molecular formula C15H13Cl2N4O3S+ and a molecular weight of 400.27 g/mol. Its IUPAC name is 2-[[1-(2,4-dichlorophenyl)-2,3-dihydrotetrazol-2-ium-5-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[[1-(2,4-dichlorophenyl)-2,3-dihydrotetrazol-2-ium-5-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 169244116 |
| Molecular Formula | C15H13Cl2N4O3S+ |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 2-[[1-(2,4-dichlorophenyl)-2,3-dihydrotetrazol-2-ium-5-yl]sulfanyl]-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CSC1=NN[NH2+]N1c1ccc(Cl)cc1Cl)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H12Cl2N4O3S/c16-9-2-3-11(10(17)6-9)21-15(18-19-20-21)25-7-14(24)8-1-4-12(22)13(23)5-8/h1-6,19-20,22-23H,7H2/p+1 |
| InChIKey | WTERBNACSJZLMT-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|