C18H28N2O — CID 169244365
5-(cyclopropylmethoxy)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-indole;molecular hydrogen (PubChem CID 169244365) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-(cyclopropylmethoxy)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-indole;molecular hydrogen.
| Compound Name | 5-(cyclopropylmethoxy)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-indole;molecular hydrogen |
|---|---|
| PubChem CID | 169244365 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 5-(cyclopropylmethoxy)-3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-indole;molecular hydrogen |
| SMILES | CN1CCC[C@@H]1CC1CNc2ccc(OCC3CC3)cc21.[H][H] |
| InChI | InChI=1S/C18H26N2O.H2/c1-20-8-2-3-15(20)9-14-11-19-18-7-6-16(10-17(14)18)21-12-13-4-5-13;/h6-7,10,13-15,19H,2-5,8-9,11-12H2,1H3;1H/t14?,15-;/m1./s1 |
| InChIKey | XCSRILCPMXLMQZ-NUNOUFIPSA-N |
| XLogP | 3.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|