C14H30N2S — CID 169244945
N,2-dimethylpropan-2-amine;5-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole (PubChem CID 169244945) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is N,2-dimethylpropan-2-amine;5-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole.
| Compound Name | N,2-dimethylpropan-2-amine;5-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole |
|---|---|
| PubChem CID | 169244945 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N,2-dimethylpropan-2-amine;5-propan-2-yl-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole |
| SMILES | CC(C)N1CC2CSCC2C1.CNC(C)(C)C |
| InChI | InChI=1S/C9H17NS.C5H13N/c1-7(2)10-3-8-5-11-6-9(8)4-10;1-5(2,3)6-4/h7-9H,3-6H2,1-2H3;6H,1-4H3 |
| InChIKey | HSYFAJYQSBBCAP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |