About 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol
2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol (PubChem CID 169245451) has the molecular formula C12H20FNO
and a molecular weight of 213.30 g/mol. Its IUPAC name is 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol |
| PubChem CID | 169245451 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol |
| SMILES | CCCCNCC(O)C1=C(F)CCC=C1 |
| InChI | InChI=1S/C12H20FNO/c1-2-3-8-14-9-12(15)10-6-4-5-7-11(10)13/h4,6,12,14-15H,2-3,5,7-9H2,1H3 |
| InChIKey | SKJXLVBRQVUKHU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol?
The IUPAC name of 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol (CID 169245451) is 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol.
What is the SMILES notation for 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol?
The canonical SMILES for 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol is CCCCNCC(O)C1=C(F)CCC=C1.
What is the InChIKey of 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol?
The InChIKey is SKJXLVBRQVUKHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20FNO/c1-2-3-8-14-9-12(15)10-6-4-5-7-11(10)13/h4,6,12,14-15H,2-3,5,7-9H2,1H3.
What are the key properties of 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol?
2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol has a molecular weight of 213.30 g/mol, XLogP of 2.31, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)-1-(2-fluorocyclohexa-1,5-dien-1-yl)ethanol is sourced from PubChem (CID 169245451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).