About N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine
N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine (PubChem CID 169245569) has the molecular formula C15H22BrFN2
and a molecular weight of 329.26 g/mol. Its IUPAC name is N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine |
| PubChem CID | 169245569 |
| Molecular Formula | C15H22BrFN2 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine |
| SMILES | CC(C)C(c1cccc(Br)c1F)N(CCN)C1CC1 |
| InChI | InChI=1S/C15H22BrFN2/c1-10(2)15(19(9-8-18)11-6-7-11)12-4-3-5-13(16)14(12)17/h3-5,10-11,15H,6-9,18H2,1-2H3 |
| InChIKey | NGKSPLVMNUFZPZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine?
The IUPAC name of N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine (CID 169245569) is N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine.
What is the SMILES notation for N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine?
The canonical SMILES for N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine is CC(C)C(c1cccc(Br)c1F)N(CCN)C1CC1.
What is the InChIKey of N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine?
The InChIKey is NGKSPLVMNUFZPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrFN2/c1-10(2)15(19(9-8-18)11-6-7-11)12-4-3-5-13(16)14(12)17/h3-5,10-11,15H,6-9,18H2,1-2H3.
What are the key properties of N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine?
N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine has a molecular weight of 329.26 g/mol, XLogP of 3.71, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(3-bromo-2-fluorophenyl)-2-methylpropyl]-N'-cyclopropylethane-1,2-diamine is sourced from PubChem (CID 169245569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).