About N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine
N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine (PubChem CID 169245657) has the molecular formula C12H16BrF3N2S
and a molecular weight of 357.24 g/mol. Its IUPAC name is N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine |
| PubChem CID | 169245657 |
| Molecular Formula | C12H16BrF3N2S |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine |
| SMILES | CC(F)(F)C(c1scc(Br)c1F)N(CCN)C1CC1 |
| InChI | InChI=1S/C12H16BrF3N2S/c1-12(15,16)11(10-9(14)8(13)6-19-10)18(5-4-17)7-2-3-7/h6-7,11H,2-5,17H2,1H3 |
| InChIKey | JUCPDZSGMUBMHD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine?
The IUPAC name of N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine (CID 169245657) is N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine.
What is the SMILES notation for N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine?
The canonical SMILES for N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine is CC(F)(F)C(c1scc(Br)c1F)N(CCN)C1CC1.
What is the InChIKey of N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine?
The InChIKey is JUCPDZSGMUBMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrF3N2S/c1-12(15,16)11(10-9(14)8(13)6-19-10)18(5-4-17)7-2-3-7/h6-7,11H,2-5,17H2,1H3.
What are the key properties of N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine?
N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine has a molecular weight of 357.24 g/mol, XLogP of 3.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(4-bromo-3-fluorothiophen-2-yl)-2,2-difluoropropyl]-N'-cyclopropylethane-1,2-diamine is sourced from PubChem (CID 169245657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).