About 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride
3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride (PubChem CID 169245718) has the molecular formula C14H15BrClNO3Se
and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride.
Molecular Properties
| Compound Name | 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride |
| PubChem CID | 169245718 |
| Molecular Formula | C14H15BrClNO3Se |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 438.91 |
| IUPAC Name | 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride |
| SMILES | O=C(O)c1cc[n+]2[se]c(C3(O)CCCCC3)c(Br)c2c1.[Cl-] |
| InChI | InChI=1S/C14H14BrNO3Se.ClH/c15-11-10-8-9(13(17)18)4-7-16(10)20-12(11)14(19)5-2-1-3-6-14;/h4,7-8,19H,1-3,5-6H2;1H |
| InChIKey | OLRNKVJFIXHRGS-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 61.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride?
The IUPAC name of 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride (CID 169245718) is 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride.
What is the SMILES notation for 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride?
The canonical SMILES for 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride is O=C(O)c1cc[n+]2[se]c(C3(O)CCCCC3)c(Br)c2c1.[Cl-].
What is the InChIKey of 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride?
The InChIKey is OLRNKVJFIXHRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO3Se.ClH/c15-11-10-8-9(13(17)18)4-7-16(10)20-12(11)14(19)5-2-1-3-6-14;/h4,7-8,19H,1-3,5-6H2;1H.
What are the key properties of 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride?
3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride has a molecular weight of 439.60 g/mol, XLogP of -0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(1-hydroxycyclohexyl)-[1,2]selenazolo[2,3-a]pyridin-8-ium-5-carboxylic acid chloride is sourced from PubChem (CID 169245718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).