C15H23F3N2O2 — CID 169246619
2-[3,6-dimethoxy-5-(6,6,6-trifluorohexyl)-2-pyridinyl]ethanamine (PubChem CID 169246619) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[3,6-dimethoxy-5-(6,6,6-trifluorohexyl)-2-pyridinyl]ethanamine.
| Compound Name | 2-[3,6-dimethoxy-5-(6,6,6-trifluorohexyl)-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 169246619 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[3,6-dimethoxy-5-(6,6,6-trifluorohexyl)-2-pyridinyl]ethanamine |
| SMILES | COc1cc(CCCCCC(F)(F)F)c(OC)nc1CCN |
| InChI | InChI=1S/C15H23F3N2O2/c1-21-13-10-11(6-4-3-5-8-15(16,17)18)14(22-2)20-12(13)7-9-19/h10H,3-9,19H2,1-2H3 |
| InChIKey | CBINJHXZBJFYBS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|