C20H24FN7 — CID 169246684
5-[1-[3-(6-fluoro-3-pyridinyl)-6-methyl-2-pyridinyl]piperidin-4-yl]-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 169246684) has the molecular formula C20H24FN7 and a molecular weight of 381.46 g/mol. Its IUPAC name is 5-[1-[3-(6-fluoro-3-pyridinyl)-6-methyl-2-pyridinyl]piperidin-4-yl]-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[1-[3-(6-fluoro-3-pyridinyl)-6-methyl-2-pyridinyl]piperidin-4-yl]-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 169246684 |
| Molecular Formula | C20H24FN7 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 5-[1-[3-(6-fluoro-3-pyridinyl)-6-methyl-2-pyridinyl]piperidin-4-yl]-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(C2CCN(c3nc(C)ccc3-c3ccc(F)nc3)CC2)n1C |
| InChI | InChI=1S/C20H24FN7/c1-13-4-6-16(15-5-7-17(21)23-12-15)19(24-13)28-10-8-14(9-11-28)18-25-26-20(22-2)27(18)3/h4-7,12,14H,8-11H2,1-3H3,(H,22,26) |
| InChIKey | NNNVLYGHDURXTR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|