C13H18N2O — CID 169246826
6-cyclopropyl-N,4-diethylpyridine-2-carboxamide (PubChem CID 169246826) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-cyclopropyl-N,4-diethylpyridine-2-carboxamide.
| Compound Name | 6-cyclopropyl-N,4-diethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 169246826 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 6-cyclopropyl-N,4-diethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(CC)cc(C2CC2)n1 |
| InChI | InChI=1S/C13H18N2O/c1-3-9-7-11(10-5-6-10)15-12(8-9)13(16)14-4-2/h7-8,10H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | UYLNWTZTADNWCB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |