C23H44N2O — CID 169246868
ethane;methanamine;2-(4-methylcyclohexyl)-N-(1-phenylpropan-2-yl)acetamide (PubChem CID 169246868) has the molecular formula C23H44N2O and a molecular weight of 364.62 g/mol. Its IUPAC name is ethane;methanamine;2-(4-methylcyclohexyl)-N-(1-phenylpropan-2-yl)acetamide.
| Compound Name | ethane;methanamine;2-(4-methylcyclohexyl)-N-(1-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 169246868 |
| Molecular Formula | C23H44N2O |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.35 |
| IUPAC Name | ethane;methanamine;2-(4-methylcyclohexyl)-N-(1-phenylpropan-2-yl)acetamide |
| SMILES | CC.CC.CC1CCC(CC(=O)NC(C)Cc2ccccc2)CC1.CN |
| InChI | InChI=1S/C18H27NO.2C2H6.CH5N/c1-14-8-10-17(11-9-14)13-18(20)19-15(2)12-16-6-4-3-5-7-16;3*1-2/h3-7,14-15,17H,8-13H2,1-2H3,(H,19,20);2*1-2H3;2H2,1H3 |
| InChIKey | VIVZUYAFYIMFQP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |