C13H24NORe- — CID 169246955
ethane;8-propan-2-yl-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-ide;rhenium (PubChem CID 169246955) has the molecular formula C13H24NORe- and a molecular weight of 396.55 g/mol. Its IUPAC name is ethane;8-propan-2-yl-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-ide;rhenium.
| Compound Name | ethane;8-propan-2-yl-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-ide;rhenium |
|---|---|
| PubChem CID | 169246955 |
| Molecular Formula | C13H24NORe- |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | ethane;8-propan-2-yl-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrol-7-ide;rhenium |
| SMILES | CC.CC(C)C1[N-]CC2CC=CCOC21.[Re] |
| InChI | InChI=1S/C11H18NO.C2H6.Re/c1-8(2)10-11-9(7-12-10)5-3-4-6-13-11;1-2;/h3-4,8-11H,5-7H2,1-2H3;1-2H3;/q-1;; |
| InChIKey | BUDUFVFCVOQGFZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|