C11H19NO — CID 169246956
8-propan-2-yl-5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole (PubChem CID 169246956) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 8-propan-2-yl-5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole.
| Compound Name | 8-propan-2-yl-5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 169246956 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 8-propan-2-yl-5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole |
| SMILES | CC(C)C1NCC2CC=CCOC21 |
| InChI | InChI=1S/C11H19NO/c1-8(2)10-11-9(7-12-10)5-3-4-6-13-11/h3-4,8-12H,5-7H2,1-2H3 |
| InChIKey | WEXQHGAXZZNKSK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|