C21H33FN2O6S — CID 169247041
N-[(6Z,9R)-4-fluoro-11,12,13-trihydroxy-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 169247041) has the molecular formula C21H33FN2O6S and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[(6Z,9R)-4-fluoro-11,12,13-trihydroxy-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[(6Z,9R)-4-fluoro-11,12,13-trihydroxy-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 169247041 |
| Molecular Formula | C21H33FN2O6S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[(6Z,9R)-4-fluoro-11,12,13-trihydroxy-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | O=C(N[C@@H]1C/C=C\CC(F)CSC2OC1C(O)C(O)C2O)C1NCC2CCCCOC21 |
| InChI | InChI=1S/C21H33FN2O6S/c22-12-6-1-2-7-13(19-16(26)15(25)17(27)21(30-19)31-10-12)24-20(28)14-18-11(9-23-14)5-3-4-8-29-18/h1-2,11-19,21,23,25-27H,3-10H2,(H,24,28)/b2-1-/t11?,12?,13-,14?,15?,16?,17?,18?,19?,21?/m1/s1 |
| InChIKey | GZTWZCYFMCONJY-KJVLWOAVSA-N |
| XLogP | -0.14 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|