C22H35FN2O6S — CID 169247121
N-[(3S,5Z)-3-(fluoromethyl)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 169247121) has the molecular formula C22H35FN2O6S and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[(3S,5Z)-3-(fluoromethyl)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[(3S,5Z)-3-(fluoromethyl)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 169247121 |
| Molecular Formula | C22H35FN2O6S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N-[(3S,5Z)-3-(fluoromethyl)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CC1/C=C\C[C@@H](CF)SC2OC(C(O)C(O)C2O)C1NC(=O)C1NCC2CCCCOC21 |
| InChI | InChI=1S/C22H35FN2O6S/c1-11-5-4-7-13(9-23)32-22-18(28)16(26)17(27)20(31-22)14(11)25-21(29)15-19-12(10-24-15)6-2-3-8-30-19/h4-5,11-20,22,24,26-28H,2-3,6-10H2,1H3,(H,25,29)/b5-4-/t11?,12?,13-,14?,15?,16?,17?,18?,19?,20?,22?/m0/s1 |
| InChIKey | AFVNENYEJKQWQL-PKHAXLIWSA-N |
| XLogP | 0.10 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|