C13H13N4O2 — CID 169248442
CID 169248442 (PubChem CID 169248442) has the molecular formula C13H13N4O2 and a molecular weight of 257.27 g/mol.
| Compound Name | CID 169248442 |
|---|---|
| PubChem CID | 169248442 |
| Molecular Formula | C13H13N4O2 |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | — |
| SMILES | COc1ccnc(C(=O)NC2=NN=C(C3CC3)[CH]2)c1 |
| InChI | InChI=1S/C13H13N4O2/c1-19-9-4-5-14-11(6-9)13(18)15-12-7-10(16-17-12)8-2-3-8/h4-8H,2-3H2,1H3,(H,15,17,18) |
| InChIKey | WXKCBCBHEFGQRY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |