5-oxo-6H-1,6-naphthyridine-3-carboxylic acid

C9H6N2O3 — CID 169248759

IUPAC5-oxo-6H-1,6-naphthyridine-3-carboxylic acid
SMILESO=C(O)c1cnc2cc[nH]c(=O)c2c1
InChIInChI=1S/C9H6N2O3/c12-8-6-3-5(9(13)14)4-11-7(6)1-2-10-8/h1-4H,(H,10,12)(H,13,14)
InChIKeyOXDOJKHMPOCHNY-UHFFFAOYSA-N
MW190.16 g/mol
LogP0.62
Rot. Bonds1

About 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid

5-oxo-6H-1,6-naphthyridine-3-carboxylic acid (PubChem CID 169248759) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-oxo-6H-1,6-naphthyridine-3-carboxylic acid
PubChem CID169248759
Molecular FormulaC9H6N2O3
Molecular Weight190.16 g/mol
Exact Mass190.04
IUPAC Name5-oxo-6H-1,6-naphthyridine-3-carboxylic acid
SMILESO=C(O)c1cnc2cc[nH]c(=O)c2c1
InChIInChI=1S/C9H6N2O3/c12-8-6-3-5(9(13)14)4-11-7(6)1-2-10-8/h1-4H,(H,10,12)(H,13,14)
InChIKeyOXDOJKHMPOCHNY-UHFFFAOYSA-N
XLogP0.62
TPSA83.05 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid?
The IUPAC name of 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid (CID 169248759) is 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid?
The canonical SMILES for 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid is O=C(O)c1cnc2cc[nH]c(=O)c2c1.
What is the InChIKey of 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid?
The InChIKey is OXDOJKHMPOCHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-8-6-3-5(9(13)14)4-11-7(6)1-2-10-8/h1-4H,(H,10,12)(H,13,14).
What are the key properties of 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid?
5-oxo-6H-1,6-naphthyridine-3-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-6H-1,6-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 169248759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).