About (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine
(5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine (PubChem CID 169248898) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine.
Molecular Properties
| Compound Name | (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine |
| PubChem CID | 169248898 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine |
| SMILES | CC/N=C1\CC/C(C)=C\C=C/N1 |
| InChI | InChI=1S/C10H16N2/c1-3-11-10-7-6-9(2)5-4-8-12-10/h4-5,8H,3,6-7H2,1-2H3,(H,11,12)/b8-4-,9-5- |
| InChIKey | QFAPJZGMEWHGQE-XEQVNJCQSA-N |
| XLogP | 2.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine?
The IUPAC name of (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine (CID 169248898) is (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine.
What is the SMILES notation for (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine?
The canonical SMILES for (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine is CC/N=C1\CC/C(C)=C\C=C/N1.
What is the InChIKey of (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine?
The InChIKey is QFAPJZGMEWHGQE-XEQVNJCQSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-11-10-7-6-9(2)5-4-8-12-10/h4-5,8H,3,6-7H2,1-2H3,(H,11,12)/b8-4-,9-5-.
What are the key properties of (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine?
(5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine has a molecular weight of 164.25 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,7Z)-N-ethyl-5-methyl-3,4-dihydro-1H-azocin-2-imine is sourced from PubChem (CID 169248898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).