About 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline
1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline (PubChem CID 169248931) has the molecular formula C21H27NO2
and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline |
| PubChem CID | 169248931 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline |
| SMILES | CC.CC(=O)OC(C)=C1C=CC=C1.CC1=NCCc2ccccc21 |
| InChI | InChI=1S/C10H11N.C9H10O2.C2H6/c1-8-10-5-3-2-4-9(10)6-7-11-8;1-7(11-8(2)10)9-5-3-4-6-9;1-2/h2-5H,6-7H2,1H3;3-6H,1-2H3;1-2H3 |
| InChIKey | GEIMNIGSBMXEIO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline?
The IUPAC name of 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline (CID 169248931) is 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline is CC.CC(=O)OC(C)=C1C=CC=C1.CC1=NCCc2ccccc21.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline?
The InChIKey is GEIMNIGSBMXEIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C9H10O2.C2H6/c1-8-10-5-3-2-4-9(10)6-7-11-8;1-7(11-8(2)10)9-5-3-4-6-9;1-2/h2-5H,6-7H2,1H3;3-6H,1-2H3;1-2H3.
What are the key properties of 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline?
1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline has a molecular weight of 325.45 g/mol, XLogP of 5.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-ylideneethyl acetate;ethane;1-methyl-3,4-dihydroisoquinoline is sourced from PubChem (CID 169248931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).