C21H31BClF2NO2 — CID 169249194
2-tert-butyl-3-chloro-6-(4,4-difluorocyclohexyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 169249194) has the molecular formula C21H31BClF2NO2 and a molecular weight of 413.75 g/mol. Its IUPAC name is 2-tert-butyl-3-chloro-6-(4,4-difluorocyclohexyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-tert-butyl-3-chloro-6-(4,4-difluorocyclohexyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 169249194 |
| Molecular Formula | C21H31BClF2NO2 |
| Molecular Weight | 413.75 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-tert-butyl-3-chloro-6-(4,4-difluorocyclohexyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC(C)(C)c1nc(C2CCC(F)(F)CC2)c(B2OC(C)(C)C(C)(C)O2)cc1Cl |
| InChI | InChI=1S/C21H31BClF2NO2/c1-18(2,3)17-15(23)12-14(22-27-19(4,5)20(6,7)28-22)16(26-17)13-8-10-21(24,25)11-9-13/h12-13H,8-11H2,1-7H3 |
| InChIKey | WHBGXNNUUIHQGT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|