About ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate
ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate (PubChem CID 169249208) has the molecular formula C16H22F2N2O2
and a molecular weight of 312.36 g/mol. Its IUPAC name is ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate |
| PubChem CID | 169249208 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(C(C)(C)C)nc1C1=CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-5-22-14(21)12-10-20(15(2,3)4)19-13(12)11-6-8-16(17,18)9-7-11/h6,10H,5,7-9H2,1-4H3 |
| InChIKey | LELMWJHOLKIWQO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate (CID 169249208) is ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate is CCOC(=O)c1cn(C(C)(C)C)nc1C1=CCC(F)(F)CC1.
What is the InChIKey of ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate?
The InChIKey is LELMWJHOLKIWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F2N2O2/c1-5-22-14(21)12-10-20(15(2,3)4)19-13(12)11-6-8-16(17,18)9-7-11/h6,10H,5,7-9H2,1-4H3.
What are the key properties of ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate?
ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate has a molecular weight of 312.36 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-tert-butyl-3-(4,4-difluorocyclohexen-1-yl)pyrazole-4-carboxylate is sourced from PubChem (CID 169249208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).