About [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid
[2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid (PubChem CID 169249268) has the molecular formula C16H12BF2NO3
and a molecular weight of 315.08 g/mol. Its IUPAC name is [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid.
Molecular Properties
| Compound Name | [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid |
| PubChem CID | 169249268 |
| Molecular Formula | C16H12BF2NO3 |
| Molecular Weight | 315.08 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid |
| SMILES | Cc1c(Oc2nc3ccccc3cc2B(O)O)ccc(F)c1F |
| InChI | InChI=1S/C16H12BF2NO3/c1-9-14(7-6-12(18)15(9)19)23-16-11(17(21)22)8-10-4-2-3-5-13(10)20-16/h2-8,21-22H,1H3 |
| InChIKey | RTRJSAVNOYSROA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid?
The IUPAC name of [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid (CID 169249268) is [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid.
What is the SMILES notation for [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid?
The canonical SMILES for [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid is Cc1c(Oc2nc3ccccc3cc2B(O)O)ccc(F)c1F.
What is the InChIKey of [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid?
The InChIKey is RTRJSAVNOYSROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BF2NO3/c1-9-14(7-6-12(18)15(9)19)23-16-11(17(21)22)8-10-4-2-3-5-13(10)20-16/h2-8,21-22H,1H3.
What are the key properties of [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid?
[2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid has a molecular weight of 315.08 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-difluoro-2-methylphenoxy)quinolin-3-yl]boronic acid is sourced from PubChem (CID 169249268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).