C28H29N5O2 — CID 169249485
2-[2-[(4aS,7aS)-4a,7a-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-2-yl]quinolin-3-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 169249485) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[2-[(4aS,7aS)-4a,7a-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-2-yl]quinolin-3-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[2-[(4aS,7aS)-4a,7a-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-2-yl]quinolin-3-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 169249485 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-[2-[(4aS,7aS)-4a,7a-dimethyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyridin-2-yl]quinolin-3-yl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | C[C@@]12CCC[C@]1(C)CN(c1nc3ccccc3cc1-c1cc(=O)c3c(C(N)=O)nccc3[nH]1)CC2 |
| InChI | InChI=1S/C28H29N5O2/c1-27-9-5-10-28(27,2)16-33(13-11-27)26-18(14-17-6-3-4-7-19(17)32-26)21-15-22(34)23-20(31-21)8-12-30-24(23)25(29)35/h3-4,6-8,12,14-15H,5,9-11,13,16H2,1-2H3,(H2,29,35)(H,31,34)/t27-,28+/m0/s1 |
| InChIKey | BVPYLAINANSCOQ-WUFINQPMSA-N |
| XLogP | 4.64 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |