C8H15F2N — CID 169250379
7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole;molecular hydrogen (PubChem CID 169250379) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is 7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole;molecular hydrogen.
| Compound Name | 7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole;molecular hydrogen |
|---|---|
| PubChem CID | 169250379 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole;molecular hydrogen |
| SMILES | FC1(F)CCCC2CNCC21.[H][H] |
| InChI | InChI=1S/C8H13F2N.H2/c9-8(10)3-1-2-6-4-11-5-7(6)8;/h6-7,11H,1-5H2;1H |
| InChIKey | UTZPXMXTWZYEPS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |