About 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane
1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane (PubChem CID 169250563) has the molecular formula C12H15BrF2N2
and a molecular weight of 305.17 g/mol. Its IUPAC name is 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane.
Molecular Properties
| Compound Name | 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane |
| PubChem CID | 169250563 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane |
| SMILES | Cc1cnc(N2CCCC(F)(F)CC2)c(Br)c1 |
| InChI | InChI=1S/C12H15BrF2N2/c1-9-7-10(13)11(16-8-9)17-5-2-3-12(14,15)4-6-17/h7-8H,2-6H2,1H3 |
| InChIKey | XNBAOFSTPZMCEU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane?
The IUPAC name of 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane (CID 169250563) is 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane.
What is the SMILES notation for 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane?
The canonical SMILES for 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane is Cc1cnc(N2CCCC(F)(F)CC2)c(Br)c1.
What is the InChIKey of 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane?
The InChIKey is XNBAOFSTPZMCEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrF2N2/c1-9-7-10(13)11(16-8-9)17-5-2-3-12(14,15)4-6-17/h7-8H,2-6H2,1H3.
What are the key properties of 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane?
1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane has a molecular weight of 305.17 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-5-methyl-2-pyridinyl)-4,4-difluoroazepane is sourced from PubChem (CID 169250563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).