About N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine
N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine (PubChem CID 169251477) has the molecular formula C17H26ClN3O2
and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine.
Molecular Properties
| Compound Name | N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine |
| PubChem CID | 169251477 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine |
| SMILES | C1CCNCC1.CC.CN(C=O)/C=C/C(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C10H9ClN2O2.C5H11N.C2H6/c1-13(7-14)5-3-10(15)9-6-8(11)2-4-12-9;1-2-4-6-5-3-1;1-2/h2-7H,1H3;6H,1-5H2;1-2H3/b5-3+;; |
| InChIKey | DQVFJHXRQBDEGH-RQCPZROWSA-N |
| XLogP | 3.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine?
The IUPAC name of N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine (CID 169251477) is N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine.
What is the SMILES notation for N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine?
The canonical SMILES for N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine is C1CCNCC1.CC.CN(C=O)/C=C/C(=O)c1cc(Cl)ccn1.
What is the InChIKey of N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine?
The InChIKey is DQVFJHXRQBDEGH-RQCPZROWSA-N. The full InChI is InChI=1S/C10H9ClN2O2.C5H11N.C2H6/c1-13(7-14)5-3-10(15)9-6-8(11)2-4-12-9;1-2-4-6-5-3-1;1-2/h2-7H,1H3;6H,1-5H2;1-2H3/b5-3+;;.
What are the key properties of N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine?
N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine has a molecular weight of 339.87 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-(4-chloro-2-pyridinyl)-3-oxoprop-1-enyl]-N-methylformamide;ethane;piperidine is sourced from PubChem (CID 169251477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).