C17H15ClF2N2O3S — CID 16925163
1-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)pyrrolidine-2-carboxamide (PubChem CID 16925163) has the molecular formula C17H15ClF2N2O3S and a molecular weight of 400.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16925163 |
| Molecular Formula | C17H15ClF2N2O3S |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(2,4-difluorophenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClF2N2O3S/c18-11-3-6-13(7-4-11)26(24,25)22-9-1-2-16(22)17(23)21-15-8-5-12(19)10-14(15)20/h3-8,10,16H,1-2,9H2,(H,21,23) |
| InChIKey | ZHRHRMSFFHWSJW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |