About 2,7-diethyl-6,6-dimethyl-1,4-diazepine
2,7-diethyl-6,6-dimethyl-1,4-diazepine (PubChem CID 169251712) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2,7-diethyl-6,6-dimethyl-1,4-diazepine.
Molecular Properties
| Compound Name | 2,7-diethyl-6,6-dimethyl-1,4-diazepine |
| PubChem CID | 169251712 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2,7-diethyl-6,6-dimethyl-1,4-diazepine |
| SMILES | CCC1=CN=CC(C)(C)C(CC)=N1 |
| InChI | InChI=1S/C11H18N2/c1-5-9-7-12-8-11(3,4)10(6-2)13-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | VNXUPMWRUYZVJC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-diethyl-6,6-dimethyl-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diethyl-6,6-dimethyl-1,4-diazepine?
The IUPAC name of 2,7-diethyl-6,6-dimethyl-1,4-diazepine (CID 169251712) is 2,7-diethyl-6,6-dimethyl-1,4-diazepine.
What is the SMILES notation for 2,7-diethyl-6,6-dimethyl-1,4-diazepine?
The canonical SMILES for 2,7-diethyl-6,6-dimethyl-1,4-diazepine is CCC1=CN=CC(C)(C)C(CC)=N1.
What is the InChIKey of 2,7-diethyl-6,6-dimethyl-1,4-diazepine?
The InChIKey is VNXUPMWRUYZVJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-5-9-7-12-8-11(3,4)10(6-2)13-9/h7-8H,5-6H2,1-4H3.
What are the key properties of 2,7-diethyl-6,6-dimethyl-1,4-diazepine?
2,7-diethyl-6,6-dimethyl-1,4-diazepine has a molecular weight of 178.28 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diethyl-6,6-dimethyl-1,4-diazepine is sourced from PubChem (CID 169251712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).