C26H20Cl2F3N5O3S — CID 169251812
N-[6-[4-[3-chloro-4-(2-chloroethoxy)-5-cyano-N-(2,2,2-trifluoroethyl)anilino]phenyl]quinoxalin-2-yl]methanesulfonamide (PubChem CID 169251812) has the molecular formula C26H20Cl2F3N5O3S and a molecular weight of 610.45 g/mol. Its IUPAC name is N-[6-[4-[3-chloro-4-(2-chloroethoxy)-5-cyano-N-(2,2,2-trifluoroethyl)anilino]phenyl]quinoxalin-2-yl]methanesulfonamide.
| Compound Name | N-[6-[4-[3-chloro-4-(2-chloroethoxy)-5-cyano-N-(2,2,2-trifluoroethyl)anilino]phenyl]quinoxalin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 169251812 |
| Molecular Formula | C26H20Cl2F3N5O3S |
| Molecular Weight | 610.45 g/mol |
| Exact Mass | 609.06 |
| IUPAC Name | N-[6-[4-[3-chloro-4-(2-chloroethoxy)-5-cyano-N-(2,2,2-trifluoroethyl)anilino]phenyl]quinoxalin-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cnc2cc(-c3ccc(N(CC(F)(F)F)c4cc(Cl)c(OCCCl)c(C#N)c4)cc3)ccc2n1 |
| InChI | InChI=1S/C26H20Cl2F3N5O3S/c1-40(37,38)35-24-14-33-23-11-17(4-7-22(23)34-24)16-2-5-19(6-3-16)36(15-26(29,30)31)20-10-18(13-32)25(21(28)12-20)39-9-8-27/h2-7,10-12,14H,8-9,15H2,1H3,(H,34,35) |
| InChIKey | XTTUVDJDDFXEBK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|